C9H14O6 — CID 59945018
5-(hydroperoxymethyl)cyclohexane-1,3-dicarboxylic acid (PubChem CID 59945018) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is 5-(hydroperoxymethyl)cyclohexane-1,3-dicarboxylic acid.
| Compound Name | 5-(hydroperoxymethyl)cyclohexane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 59945018 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 5-(hydroperoxymethyl)cyclohexane-1,3-dicarboxylic acid |
| SMILES | O=C(O)C1CC(COO)CC(C(=O)O)C1 |
| InChI | InChI=1S/C9H14O6/c10-8(11)6-1-5(4-15-14)2-7(3-6)9(12)13/h5-7,14H,1-4H2,(H,10,11)(H,12,13) |
| InChIKey | OMWZOYCZHKTAMQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|