C35H33N2OS2+ — CID 20690163
2-[(E)-[3-[(E,3Z)-3-(3,5-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-2-methyl-5-phenylcyclohex-2-en-1-ylidene]methyl]-9-oxa-3-thia-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene (PubChem CID 20690163) has the molecular formula C35H33N2OS2+ and a molecular weight of 561.80 g/mol. Its IUPAC name is 2-[(E)-[3-[(E,3Z)-3-(3,5-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-2-methyl-5-phenylcyclohex-2-en-1-ylidene]methyl]-9-oxa-3-thia-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene.
| Compound Name | 2-[(E)-[3-[(E,3Z)-3-(3,5-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-2-methyl-5-phenylcyclohex-2-en-1-ylidene]methyl]-9-oxa-3-thia-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 20690163 |
| Molecular Formula | C35H33N2OS2+ |
| Molecular Weight | 561.80 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 2-[(E)-[3-[(E,3Z)-3-(3,5-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-2-methyl-5-phenylcyclohex-2-en-1-ylidene]methyl]-9-oxa-3-thia-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene |
| SMILES | CC1=C(/C=C/C=C2\Sc3ccc(C)cc3N2C)CC(c2ccccc2)C/C1=C\c1sc2cccc3c2[n+]1CCO3 |
| InChI | InChI=1S/C35H33N2OS2/c1-23-15-16-31-29(19-23)36(3)33(39-31)14-7-11-26-20-28(25-9-5-4-6-10-25)21-27(24(26)2)22-34-37-17-18-38-30-12-8-13-32(40-34)35(30)37/h4-16,19,22,28H,17-18,20-21H2,1-3H3/q+1 |
| InChIKey | HRQMURWMNQMERF-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.80 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|