C14H26O2 — CID 20692056
5-methyl-2-propan-2-yl-2-[(E)-prop-1-enyl]-5-propyl-1,3-dioxane (PubChem CID 20692056) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 5-methyl-2-propan-2-yl-2-[(E)-prop-1-enyl]-5-propyl-1,3-dioxane.
| Compound Name | 5-methyl-2-propan-2-yl-2-[(E)-prop-1-enyl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 20692056 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 5-methyl-2-propan-2-yl-2-[(E)-prop-1-enyl]-5-propyl-1,3-dioxane |
| SMILES | C/C=C/C1(C(C)C)OCC(C)(CCC)CO1 |
| InChI | InChI=1S/C14H26O2/c1-6-8-13(5)10-15-14(9-7-2,12(3)4)16-11-13/h7,9,12H,6,8,10-11H2,1-5H3/b9-7+ |
| InChIKey | VZMPYNLCYMELLD-VQHVLOKHSA-N |
| XLogP | 3.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|