C12H21ClHgO2 — CID 134986351
chloro-[[(4S,6R)-2,2-dimethyl-6-[(E)-3-methylbut-1-enyl]-1,3-dioxan-4-yl]methyl]mercury (PubChem CID 134986351) has the molecular formula C12H21ClHgO2 and a molecular weight of 433.34 g/mol. Its IUPAC name is chloro-[[(4S,6R)-2,2-dimethyl-6-[(E)-3-methylbut-1-enyl]-1,3-dioxan-4-yl]methyl]mercury.
| Compound Name | chloro-[[(4S,6R)-2,2-dimethyl-6-[(E)-3-methylbut-1-enyl]-1,3-dioxan-4-yl]methyl]mercury |
|---|---|
| PubChem CID | 134986351 |
| Molecular Formula | C12H21ClHgO2 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | chloro-[[(4S,6R)-2,2-dimethyl-6-[(E)-3-methylbut-1-enyl]-1,3-dioxan-4-yl]methyl]mercury |
| SMILES | CC(C)/C=C/[C@H]1C[C@@H](C[Hg]Cl)OC(C)(C)O1 |
| InChI | InChI=1S/C12H21O2.ClH.Hg/c1-9(2)6-7-11-8-10(3)13-12(4,5)14-11;;/h6-7,9-11H,3,8H2,1-2,4-5H3;1H;/q;;+1/p-1/b7-6+;;/t10-,11+;;/m1../s1 |
| InChIKey | TWURZBWXRIHBHF-JZEDWHPASA-M |
| XLogP | 3.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|