About isocyanatosulfinyl hypochlorite
isocyanatosulfinyl hypochlorite (PubChem CID 20694166) has the molecular formula CClNO3S
and a molecular weight of 141.53 g/mol. Its IUPAC name is isocyanatosulfinyl hypochlorite.
Molecular Properties
| Compound Name | isocyanatosulfinyl hypochlorite |
| PubChem CID | 20694166 |
| Molecular Formula | CClNO3S |
| Molecular Weight | 141.53 g/mol |
| Exact Mass | 140.93 |
| IUPAC Name | isocyanatosulfinyl hypochlorite |
| SMILES | O=C=NS(=O)OCl |
| InChI | InChI=1S/CClNO3S/c2-6-7(5)3-1-4 |
| InChIKey | GIYCSYQEOPFGCI-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.53 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanatosulfinyl hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanatosulfinyl hypochlorite?
The IUPAC name of isocyanatosulfinyl hypochlorite (CID 20694166) is isocyanatosulfinyl hypochlorite.
What is the SMILES notation for isocyanatosulfinyl hypochlorite?
The canonical SMILES for isocyanatosulfinyl hypochlorite is O=C=NS(=O)OCl.
What is the InChIKey of isocyanatosulfinyl hypochlorite?
The InChIKey is GIYCSYQEOPFGCI-UHFFFAOYSA-N. The full InChI is InChI=1S/CClNO3S/c2-6-7(5)3-1-4.
What are the key properties of isocyanatosulfinyl hypochlorite?
isocyanatosulfinyl hypochlorite has a molecular weight of 141.53 g/mol, XLogP of 0.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanatosulfinyl hypochlorite is sourced from PubChem (CID 20694166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).