C23H20FNO4 — CID 20696851
ethyl 4-[1-[(4-fluorophenyl)methyl]-5-phenylpyrrol-2-yl]-2,4-dioxobutanoate (PubChem CID 20696851) has the molecular formula C23H20FNO4 and a molecular weight of 393.41 g/mol. Its IUPAC name is ethyl 4-[1-[(4-fluorophenyl)methyl]-5-phenylpyrrol-2-yl]-2,4-dioxobutanoate.
| Compound Name | ethyl 4-[1-[(4-fluorophenyl)methyl]-5-phenylpyrrol-2-yl]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 20696851 |
| Molecular Formula | C23H20FNO4 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | ethyl 4-[1-[(4-fluorophenyl)methyl]-5-phenylpyrrol-2-yl]-2,4-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)c1ccc(-c2ccccc2)n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H20FNO4/c1-2-29-23(28)22(27)14-21(26)20-13-12-19(17-6-4-3-5-7-17)25(20)15-16-8-10-18(24)11-9-16/h3-13H,2,14-15H2,1H3 |
| InChIKey | XTBMGUTWSPQALI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|