C28H24FNO9 — CID 91936272
ethyl 4-[3-(4-ethoxy-3,4-dioxobutanoyl)-1-[(4-fluorophenyl)methyl]-4-oxoquinolin-6-yl]-2,4-dioxobutanoate (PubChem CID 91936272) has the molecular formula C28H24FNO9 and a molecular weight of 537.50 g/mol. Its IUPAC name is ethyl 4-[3-(4-ethoxy-3,4-dioxobutanoyl)-1-[(4-fluorophenyl)methyl]-4-oxoquinolin-6-yl]-2,4-dioxobutanoate.
| Compound Name | ethyl 4-[3-(4-ethoxy-3,4-dioxobutanoyl)-1-[(4-fluorophenyl)methyl]-4-oxoquinolin-6-yl]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 91936272 |
| Molecular Formula | C28H24FNO9 |
| Molecular Weight | 537.50 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | ethyl 4-[3-(4-ethoxy-3,4-dioxobutanoyl)-1-[(4-fluorophenyl)methyl]-4-oxoquinolin-6-yl]-2,4-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)c1ccc2c(c1)c(=O)c(C(=O)CC(=O)C(=O)OCC)cn2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C28H24FNO9/c1-3-38-27(36)24(33)12-22(31)17-7-10-21-19(11-17)26(35)20(23(32)13-25(34)28(37)39-4-2)15-30(21)14-16-5-8-18(29)9-6-16/h5-11,15H,3-4,12-14H2,1-2H3 |
| InChIKey | BLUWEGIFNAEAKR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 142.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|