C21H16FNO6Y — CID 91865856
1-[(4-fluorophenyl)methyl]-6-(3-methoxy-3-oxopropanoyl)-4-oxoquinoline-3-carboxylic acid;yttrium (PubChem CID 91865856) has the molecular formula C21H16FNO6Y and a molecular weight of 486.26 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-6-(3-methoxy-3-oxopropanoyl)-4-oxoquinoline-3-carboxylic acid;yttrium.
| Compound Name | 1-[(4-fluorophenyl)methyl]-6-(3-methoxy-3-oxopropanoyl)-4-oxoquinoline-3-carboxylic acid;yttrium |
|---|---|
| PubChem CID | 91865856 |
| Molecular Formula | C21H16FNO6Y |
| Molecular Weight | 486.26 g/mol |
| Exact Mass | 486.00 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-6-(3-methoxy-3-oxopropanoyl)-4-oxoquinoline-3-carboxylic acid;yttrium |
| SMILES | COC(=O)CC(=O)c1ccc2c(c1)c(=O)c(C(=O)O)cn2Cc1ccc(F)cc1.[Y] |
| InChI | InChI=1S/C21H16FNO6.Y/c1-29-19(25)9-18(24)13-4-7-17-15(8-13)20(26)16(21(27)28)11-23(17)10-12-2-5-14(22)6-3-12;/h2-8,11H,9-10H2,1H3,(H,27,28); |
| InChIKey | DGHJJRZITFRMJW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|