C17H13N2NaO6S — CID 20697740
sodium 3-[[(E)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]benzenesulfonate (PubChem CID 20697740) has the molecular formula C17H13N2NaO6S and a molecular weight of 396.36 g/mol. Its IUPAC name is sodium 3-[[(E)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]benzenesulfonate.
| Compound Name | sodium 3-[[(E)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]benzenesulfonate |
|---|---|
| PubChem CID | 20697740 |
| Molecular Formula | C17H13N2NaO6S |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | sodium 3-[[(E)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]benzenesulfonate |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2cccc(S(=O)(=O)[O-])c2)ccc1O.[Na+] |
| InChI | InChI=1S/C17H14N2O6S.Na/c1-25-16-8-11(5-6-15(16)20)7-12(10-18)17(21)19-13-3-2-4-14(9-13)26(22,23)24;/h2-9,20H,1H3,(H,19,21)(H,22,23,24);/q;+1/p-1/b12-7+; |
| InChIKey | WQCHMKFVTUGQKC-RRAJOLSVSA-M |
| XLogP | -1.15 |
| TPSA | 139.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|