C16H28O4 — CID 20698001
[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 3-propan-2-ylcyclohexane-1-carboxylate (PubChem CID 20698001) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 3-propan-2-ylcyclohexane-1-carboxylate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 3-propan-2-ylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 20698001 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 3-propan-2-ylcyclohexane-1-carboxylate |
| SMILES | CC(C)C1CCCC(C(=O)OCC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H28O4/c1-11(2)12-7-6-8-13(9-12)15(18)19-10-14(17)20-16(3,4)5/h11-13H,6-10H2,1-5H3 |
| InChIKey | MLYCWDVCWRYQLH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |