C32H30LiN3O7S2 — CID 20699659
lithium 2-[[2-(2-methylphenyl)-4-[(N-(3-nitrophenyl)sulfonylanilino)methyl]benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 20699659) has the molecular formula C32H30LiN3O7S2 and a molecular weight of 639.68 g/mol. Its IUPAC name is lithium 2-[[2-(2-methylphenyl)-4-[(N-(3-nitrophenyl)sulfonylanilino)methyl]benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | lithium 2-[[2-(2-methylphenyl)-4-[(N-(3-nitrophenyl)sulfonylanilino)methyl]benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 20699659 |
| Molecular Formula | C32H30LiN3O7S2 |
| Molecular Weight | 639.68 g/mol |
| Exact Mass | 639.17 |
| IUPAC Name | lithium 2-[[2-(2-methylphenyl)-4-[(N-(3-nitrophenyl)sulfonylanilino)methyl]benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=O)c1ccc(CN(c2ccccc2)S(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1-c1ccccc1C)C(=O)[O-].[Li+] |
| InChI | InChI=1S/C32H31N3O7S2.Li/c1-22-9-6-7-14-27(22)29-19-23(15-16-28(29)31(36)33-30(32(37)38)17-18-43-2)21-34(24-10-4-3-5-11-24)44(41,42)26-13-8-12-25(20-26)35(39)40;/h3-16,19-20,30H,17-18,21H2,1-2H3,(H,33,36)(H,37,38);/q;+1/p-1 |
| InChIKey | GPJMBFAXJLNSTC-UHFFFAOYSA-M |
| XLogP | 1.57 |
| TPSA | 149.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.68 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|