C31H32N2O6S3 — CID 91570958
methyl (2S)-2-[[2-(2-methylphenyl)-4-[(N-thiophen-2-ylsulfonylanilino)methyl]benzoyl]amino]-4-methylsulfanylbutaneperoxoate (PubChem CID 91570958) has the molecular formula C31H32N2O6S3 and a molecular weight of 624.81 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(2-methylphenyl)-4-[(N-thiophen-2-ylsulfonylanilino)methyl]benzoyl]amino]-4-methylsulfanylbutaneperoxoate.
| Compound Name | methyl (2S)-2-[[2-(2-methylphenyl)-4-[(N-thiophen-2-ylsulfonylanilino)methyl]benzoyl]amino]-4-methylsulfanylbutaneperoxoate |
|---|---|
| PubChem CID | 91570958 |
| Molecular Formula | C31H32N2O6S3 |
| Molecular Weight | 624.81 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | methyl (2S)-2-[[2-(2-methylphenyl)-4-[(N-thiophen-2-ylsulfonylanilino)methyl]benzoyl]amino]-4-methylsulfanylbutaneperoxoate |
| SMILES | COOC(=O)[C@H](CCSC)NC(=O)c1ccc(CN(c2ccccc2)S(=O)(=O)c2cccs2)cc1-c1ccccc1C |
| InChI | InChI=1S/C31H32N2O6S3/c1-22-10-7-8-13-25(22)27-20-23(15-16-26(27)30(34)32-28(17-19-40-3)31(35)39-38-2)21-33(24-11-5-4-6-12-24)42(36,37)29-14-9-18-41-29/h4-16,18,20,28H,17,19,21H2,1-3H3,(H,32,34)/t28-/m0/s1 |
| InChIKey | FLCJMQHDQWTBSL-NDEPHWFRSA-N |
| XLogP | 6.08 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.81 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|