C33H32LiN3O5S — CID 20698991
lithium (2S)-2-[[4-[(N-benzyl-3-nitroanilino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 20698991) has the molecular formula C33H32LiN3O5S and a molecular weight of 589.64 g/mol. Its IUPAC name is lithium (2S)-2-[[4-[(N-benzyl-3-nitroanilino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | lithium (2S)-2-[[4-[(N-benzyl-3-nitroanilino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 20698991 |
| Molecular Formula | C33H32LiN3O5S |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | lithium (2S)-2-[[4-[(N-benzyl-3-nitroanilino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)c1ccc(CN(Cc2ccccc2)c2cccc([N+](=O)[O-])c2)cc1-c1ccccc1C)C(=O)[O-].[Li+] |
| InChI | InChI=1S/C33H33N3O5S.Li/c1-23-9-6-7-14-28(23)30-19-25(15-16-29(30)32(37)34-31(33(38)39)17-18-42-2)22-35(21-24-10-4-3-5-11-24)26-12-8-13-27(20-26)36(40)41;/h3-16,19-20,31H,17-18,21-22H2,1-2H3,(H,34,37)(H,38,39);/q;+1/p-1/t31-;/m0./s1 |
| InChIKey | ATHTXFGRKAQJFY-YNMZEGNTSA-M |
| XLogP | 2.38 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|