C41H38LiN3O3S2 — CID 20699368
lithium 2-[[4-[[N-benzyl-4-(6-methyl-1,3-benzothiazol-2-yl)anilino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 20699368) has the molecular formula C41H38LiN3O3S2 and a molecular weight of 691.85 g/mol. Its IUPAC name is lithium 2-[[4-[[N-benzyl-4-(6-methyl-1,3-benzothiazol-2-yl)anilino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | lithium 2-[[4-[[N-benzyl-4-(6-methyl-1,3-benzothiazol-2-yl)anilino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 20699368 |
| Molecular Formula | C41H38LiN3O3S2 |
| Molecular Weight | 691.85 g/mol |
| Exact Mass | 691.25 |
| IUPAC Name | lithium 2-[[4-[[N-benzyl-4-(6-methyl-1,3-benzothiazol-2-yl)anilino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=O)c1ccc(CN(Cc2ccccc2)c2ccc(-c3nc4ccc(C)cc4s3)cc2)cc1-c1ccccc1C)C(=O)[O-].[Li+] |
| InChI | InChI=1S/C41H39N3O3S2.Li/c1-27-13-20-36-38(23-27)49-40(43-36)31-15-17-32(18-16-31)44(25-29-10-5-4-6-11-29)26-30-14-19-34(35(24-30)33-12-8-7-9-28(33)2)39(45)42-37(41(46)47)21-22-48-3;/h4-20,23-24,37H,21-22,25-26H2,1-3H3,(H,42,45)(H,46,47);/q;+1/p-1 |
| InChIKey | VESGDEFQBLLPMG-UHFFFAOYSA-M |
| XLogP | 5.06 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.85 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|