About CID 20700384
CID 20700384 (PubChem CID 20700384) has the molecular formula C13H10NSi
and a molecular weight of 208.32 g/mol.
Molecular Properties
| Compound Name | CID 20700384 |
| PubChem CID | 20700384 |
| Molecular Formula | C13H10NSi |
| Molecular Weight | 208.32 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | — |
| SMILES | [Si]c1ccc(/C=C/c2ccccc2)cn1 |
| InChI | InChI=1S/C13H10NSi/c15-13-9-8-12(10-14-13)7-6-11-4-2-1-3-5-11/h1-10H/b7-6+ |
| InChIKey | ALFHIVOLKOAFCA-VOTSOKGWSA-N |
| XLogP | 2.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 20700384 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20700384?
The IUPAC name of CID 20700384 (CID 20700384) is not available.
What is the SMILES notation for CID 20700384?
The canonical SMILES for CID 20700384 is [Si]c1ccc(/C=C/c2ccccc2)cn1.
What is the InChIKey of CID 20700384?
The InChIKey is ALFHIVOLKOAFCA-VOTSOKGWSA-N. The full InChI is InChI=1S/C13H10NSi/c15-13-9-8-12(10-14-13)7-6-11-4-2-1-3-5-11/h1-10H/b7-6+.
What are the key properties of CID 20700384?
CID 20700384 has a molecular weight of 208.32 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20700384 is sourced from PubChem (CID 20700384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).