C21H17F3N3O3S+ — CID 20703811
1,1,1-trifluoro-N-[2-[(4-phenoxyphenyl)methyl]-1H-benzimidazol-1-ium-5-yl]methanesulfonamide (PubChem CID 20703811) has the molecular formula C21H17F3N3O3S+ and a molecular weight of 448.45 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-[(4-phenoxyphenyl)methyl]-1H-benzimidazol-1-ium-5-yl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-[(4-phenoxyphenyl)methyl]-1H-benzimidazol-1-ium-5-yl]methanesulfonamide |
|---|---|
| PubChem CID | 20703811 |
| Molecular Formula | C21H17F3N3O3S+ |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-[(4-phenoxyphenyl)methyl]-1H-benzimidazol-1-ium-5-yl]methanesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)N=C(Cc1ccc(Oc3ccccc3)cc1)[NH2+]2)C(F)(F)F |
| InChI | InChI=1S/C21H16F3N3O3S/c22-21(23,24)31(28,29)27-15-8-11-18-19(13-15)26-20(25-18)12-14-6-9-17(10-7-14)30-16-4-2-1-3-5-16/h1-11,13,27H,12H2,(H,25,26)/p+1 |
| InChIKey | RJLTUEUMZOYDLX-UHFFFAOYSA-O |
| XLogP | 4.22 |
| TPSA | 84.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|