C27H24N3O4S+ — CID 20703849
4-methoxy-N-[2-[(4-phenoxyphenyl)methyl]-1H-benzimidazol-1-ium-5-yl]benzenesulfonamide (PubChem CID 20703849) has the molecular formula C27H24N3O4S+ and a molecular weight of 486.57 g/mol. Its IUPAC name is 4-methoxy-N-[2-[(4-phenoxyphenyl)methyl]-1H-benzimidazol-1-ium-5-yl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[2-[(4-phenoxyphenyl)methyl]-1H-benzimidazol-1-ium-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 20703849 |
| Molecular Formula | C27H24N3O4S+ |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 4-methoxy-N-[2-[(4-phenoxyphenyl)methyl]-1H-benzimidazol-1-ium-5-yl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc3c(c2)N=C(Cc2ccc(Oc4ccccc4)cc2)[NH2+]3)cc1 |
| InChI | InChI=1S/C27H23N3O4S/c1-33-21-12-14-24(15-13-21)35(31,32)30-20-9-16-25-26(18-20)29-27(28-25)17-19-7-10-23(11-8-19)34-22-5-3-2-4-6-22/h2-16,18,30H,17H2,1H3,(H,28,29)/p+1 |
| InChIKey | CBUFMNCWSPEPPF-UHFFFAOYSA-O |
| XLogP | 4.77 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|