C17H14F3N3O — CID 20706442
N'-[[2-(trifluoromethoxy)phenyl]methyl]-1H-indole-5-carboximidamide (PubChem CID 20706442) has the molecular formula C17H14F3N3O and a molecular weight of 333.31 g/mol. Its IUPAC name is N'-[[2-(trifluoromethoxy)phenyl]methyl]-1H-indole-5-carboximidamide.
| Compound Name | N'-[[2-(trifluoromethoxy)phenyl]methyl]-1H-indole-5-carboximidamide |
|---|---|
| PubChem CID | 20706442 |
| Molecular Formula | C17H14F3N3O |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N'-[[2-(trifluoromethoxy)phenyl]methyl]-1H-indole-5-carboximidamide |
| SMILES | N/C(=N\Cc1ccccc1OC(F)(F)F)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C17H14F3N3O/c18-17(19,20)24-15-4-2-1-3-13(15)10-23-16(21)12-5-6-14-11(9-12)7-8-22-14/h1-9,22H,10H2,(H2,21,23) |
| InChIKey | HQWLRKMGAYKYSI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|