C16H14F2N2O3 — CID 20706408
2,2-difluoro-N'-[(2-methoxyphenyl)methyl]-1,3-benzodioxole-5-carboximidamide (PubChem CID 20706408) has the molecular formula C16H14F2N2O3 and a molecular weight of 320.30 g/mol. Its IUPAC name is 2,2-difluoro-N'-[(2-methoxyphenyl)methyl]-1,3-benzodioxole-5-carboximidamide.
| Compound Name | 2,2-difluoro-N'-[(2-methoxyphenyl)methyl]-1,3-benzodioxole-5-carboximidamide |
|---|---|
| PubChem CID | 20706408 |
| Molecular Formula | C16H14F2N2O3 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2,2-difluoro-N'-[(2-methoxyphenyl)methyl]-1,3-benzodioxole-5-carboximidamide |
| SMILES | COc1ccccc1C/N=C(\N)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C16H14F2N2O3/c1-21-12-5-3-2-4-11(12)9-20-15(19)10-6-7-13-14(8-10)23-16(17,18)22-13/h2-8H,9H2,1H3,(H2,19,20) |
| InChIKey | GXFRGCVKBLNFPG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|