C43H57N5O8S — CID 20707431
2-[4-tert-butyl-2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methoxyphenyl]sulfinamoyloxyphenoxy]decanoic acid (PubChem CID 20707431) has the molecular formula C43H57N5O8S and a molecular weight of 804.02 g/mol. Its IUPAC name is 2-[4-tert-butyl-2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methoxyphenyl]sulfinamoyloxyphenoxy]decanoic acid.
| Compound Name | 2-[4-tert-butyl-2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methoxyphenyl]sulfinamoyloxyphenoxy]decanoic acid |
|---|---|
| PubChem CID | 20707431 |
| Molecular Formula | C43H57N5O8S |
| Molecular Weight | 804.02 g/mol |
| Exact Mass | 803.39 |
| IUPAC Name | 2-[4-tert-butyl-2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methoxyphenyl]sulfinamoyloxyphenoxy]decanoic acid |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(OC)c(NS(=O)Oc4cc(C(C)(C)C)ccc4OC(CCCCCCCC)C(=O)O)c3)nc2c1C(=O)OC1C(C)CC(C)CC1C |
| InChI | InChI=1S/C43H57N5O8S/c1-10-11-12-13-14-15-16-35(41(49)50)54-34-20-18-30(43(5,6)7)24-36(34)56-57(52)47-31-23-29(17-19-33(31)53-9)39-45-40-37(32(44-8)25-48(40)46-39)42(51)55-38-27(3)21-26(2)22-28(38)4/h17-20,23-28,35,38,47H,10-16,21-22H2,1-7,9H3,(H,45,46)(H,49,50) |
| InChIKey | OUXSVDRNVCWXLA-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.02 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|