C40H51N5O5 — CID 20707432
2-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methylanilino]-4-methylphenoxy]decanoic acid (PubChem CID 20707432) has the molecular formula C40H51N5O5 and a molecular weight of 681.88 g/mol. Its IUPAC name is 2-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methylanilino]-4-methylphenoxy]decanoic acid.
| Compound Name | 2-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methylanilino]-4-methylphenoxy]decanoic acid |
|---|---|
| PubChem CID | 20707432 |
| Molecular Formula | C40H51N5O5 |
| Molecular Weight | 681.88 g/mol |
| Exact Mass | 681.39 |
| IUPAC Name | 2-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methylanilino]-4-methylphenoxy]decanoic acid |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(C)c(Nc4cc(C)ccc4OC(CCCCCCCC)C(=O)O)c3)nc2c1C(=O)OC1C(C)CC(C)CC1C |
| InChI | InChI=1S/C40H51N5O5/c1-8-9-10-11-12-13-14-34(39(46)47)49-33-18-15-24(2)21-31(33)42-30-22-29(17-16-26(30)4)37-43-38-35(32(41-7)23-45(38)44-37)40(48)50-36-27(5)19-25(3)20-28(36)6/h15-18,21-23,25,27-28,34,36,42H,8-14,19-20H2,1-6H3,(H,43,44)(H,46,47) |
| InChIKey | BMJZYIMWPTYPIC-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.88 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|