C9H17ClO — CID 20707641
2-chloro-3,4,5,6-tetramethyloxane (PubChem CID 20707641) has the molecular formula C9H17ClO and a molecular weight of 176.69 g/mol. Its IUPAC name is 2-chloro-3,4,5,6-tetramethyloxane.
| Compound Name | 2-chloro-3,4,5,6-tetramethyloxane |
|---|---|
| PubChem CID | 20707641 |
| Molecular Formula | C9H17ClO |
| Molecular Weight | 176.69 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2-chloro-3,4,5,6-tetramethyloxane |
| SMILES | CC1OC(Cl)C(C)C(C)C1C |
| InChI | InChI=1S/C9H17ClO/c1-5-6(2)8(4)11-9(10)7(5)3/h5-9H,1-4H3 |
| InChIKey | TXBJAVNNMUGTQL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.69 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|