C24H38 — CID 20707704
7,10,12,13-tetramethyl-17-propan-2-yl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 20707704) has the molecular formula C24H38 and a molecular weight of 326.57 g/mol. Its IUPAC name is 7,10,12,13-tetramethyl-17-propan-2-yl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | 7,10,12,13-tetramethyl-17-propan-2-yl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 20707704 |
| Molecular Formula | C24H38 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.30 |
| IUPAC Name | 7,10,12,13-tetramethyl-17-propan-2-yl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC1=C2C(CC(C)C3(C)C2CCC3C(C)C)C2(C)CCCCC2=C1 |
| InChI | InChI=1S/C24H38/c1-15(2)19-10-11-20-22-16(3)13-18-9-7-8-12-23(18,5)21(22)14-17(4)24(19,20)6/h13,15,17,19-21H,7-12,14H2,1-6H3 |
| InChIKey | UPCXGXDXXBMCEB-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |