C19H29NO2 — CID 69493035
[(9R,10R,13R,14S)-7-amino-10-methyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-13-yl]methanediol (PubChem CID 69493035) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is [(9R,10R,13R,14S)-7-amino-10-methyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-13-yl]methanediol.
| Compound Name | [(9R,10R,13R,14S)-7-amino-10-methyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-13-yl]methanediol |
|---|---|
| PubChem CID | 69493035 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | [(9R,10R,13R,14S)-7-amino-10-methyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-13-yl]methanediol |
| SMILES | C[C@]12CCCCC1=CC(N)=C1[C@@H]3CCC[C@@]3(C(O)O)CC[C@@H]12 |
| InChI | InChI=1S/C19H29NO2/c1-18-8-3-2-5-12(18)11-15(20)16-13(18)7-10-19(17(21)22)9-4-6-14(16)19/h11,13-14,17,21-22H,2-10,20H2,1H3/t13-,14-,18-,19+/m0/s1 |
| InChIKey | QXCRMTAFNIOPQW-KODHJQJWSA-N |
| XLogP | 3.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|