C25H24Ac2O3 — CID 20708355
actinium;3-(2-hydroxy-5,5-diphenylpentyl)-1-benzofuran-7-ol (PubChem CID 20708355) has the molecular formula C25H24Ac2O3 and a molecular weight of 826.46 g/mol. Its IUPAC name is actinium;3-(2-hydroxy-5,5-diphenylpentyl)-1-benzofuran-7-ol.
| Compound Name | actinium;3-(2-hydroxy-5,5-diphenylpentyl)-1-benzofuran-7-ol |
|---|---|
| PubChem CID | 20708355 |
| Molecular Formula | C25H24Ac2O3 |
| Molecular Weight | 826.46 g/mol |
| Exact Mass | 826.23 |
| IUPAC Name | actinium;3-(2-hydroxy-5,5-diphenylpentyl)-1-benzofuran-7-ol |
| SMILES | Oc1cccc2c(CC(O)CCC(c3ccccc3)c3ccccc3)coc12.[Ac].[Ac] |
| InChI | InChI=1S/C25H24O3.2Ac/c26-21(16-20-17-28-25-23(20)12-7-13-24(25)27)14-15-22(18-8-3-1-4-9-18)19-10-5-2-6-11-19;;/h1-13,17,21-22,26-27H,14-16H2;; |
| InChIKey | VDNKPCDJOCYXPC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |