C13H12O3 — CID 20709544
1-oxo-3a,4,9,9a-tetrahydro-3H-benzo[f][2]benzofuran-4-carbaldehyde (PubChem CID 20709544) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 1-oxo-3a,4,9,9a-tetrahydro-3H-benzo[f][2]benzofuran-4-carbaldehyde.
| Compound Name | 1-oxo-3a,4,9,9a-tetrahydro-3H-benzo[f][2]benzofuran-4-carbaldehyde |
|---|---|
| PubChem CID | 20709544 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1-oxo-3a,4,9,9a-tetrahydro-3H-benzo[f][2]benzofuran-4-carbaldehyde |
| SMILES | O=CC1c2ccccc2CC2C(=O)OCC21 |
| InChI | InChI=1S/C13H12O3/c14-6-11-9-4-2-1-3-8(9)5-10-12(11)7-16-13(10)15/h1-4,6,10-12H,5,7H2 |
| InChIKey | AMUBRVNAXJIFFV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|