C27H22Cl2N4O7S — CID 20711632
3-[[2-[3-[(2,6-dichlorophenyl)sulfonylamino]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]amino]-4-oxobutanoic acid (PubChem CID 20711632) has the molecular formula C27H22Cl2N4O7S and a molecular weight of 617.47 g/mol. Its IUPAC name is 3-[[2-[3-[(2,6-dichlorophenyl)sulfonylamino]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[3-[(2,6-dichlorophenyl)sulfonylamino]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20711632 |
| Molecular Formula | C27H22Cl2N4O7S |
| Molecular Weight | 617.47 g/mol |
| Exact Mass | 616.06 |
| IUPAC Name | 3-[[2-[3-[(2,6-dichlorophenyl)sulfonylamino]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]amino]-4-oxobutanoic acid |
| SMILES | O=CC(CC(=O)O)NC(=O)CN1C(=O)C(NS(=O)(=O)c2c(Cl)cccc2Cl)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C27H22Cl2N4O7S/c28-19-10-6-11-20(29)25(19)41(39,40)32-26-27(38)33(14-22(35)30-17(15-34)13-23(36)37)21-12-5-4-9-18(21)24(31-26)16-7-2-1-3-8-16/h1-12,15,17,26,32H,13-14H2,(H,30,35)(H,36,37) |
| InChIKey | YIYXBZINOPENAD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 162.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|