C29H26ClN5O5 — CID 59976269
4-amino-3-chloro-N-[1-[2-[[(2S)-1,4-dioxopentan-2-yl]amino]-2-oxoethyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]benzamide (PubChem CID 59976269) has the molecular formula C29H26ClN5O5 and a molecular weight of 560.01 g/mol. Its IUPAC name is 4-amino-3-chloro-N-[1-[2-[[(2S)-1,4-dioxopentan-2-yl]amino]-2-oxoethyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]benzamide.
| Compound Name | 4-amino-3-chloro-N-[1-[2-[[(2S)-1,4-dioxopentan-2-yl]amino]-2-oxoethyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]benzamide |
|---|---|
| PubChem CID | 59976269 |
| Molecular Formula | C29H26ClN5O5 |
| Molecular Weight | 560.01 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 4-amino-3-chloro-N-[1-[2-[[(2S)-1,4-dioxopentan-2-yl]amino]-2-oxoethyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]benzamide |
| SMILES | CC(=O)C[C@@H](C=O)NC(=O)CN1C(=O)C(NC(=O)c2ccc(N)c(Cl)c2)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C29H26ClN5O5/c1-17(37)13-20(16-36)32-25(38)15-35-24-10-6-5-9-21(24)26(18-7-3-2-4-8-18)33-27(29(35)40)34-28(39)19-11-12-23(31)22(30)14-19/h2-12,14,16,20,27H,13,15,31H2,1H3,(H,32,38)(H,34,39)/t20-,27?/m0/s1 |
| InChIKey | CXFHRXYGXLDJJR-SVQMELKDSA-N |
| XLogP | 2.53 |
| TPSA | 151.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.01 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|