C36H26Cl4N4O8 — CID 59976322
[2,6-dichloro-4-[[1-[2-[[(2S)-1,4-dioxopentan-2-yl]amino]-2-oxoethyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamoyl]phenyl] 3,5-dichloro-4-hydroxybenzoate (PubChem CID 59976322) has the molecular formula C36H26Cl4N4O8 and a molecular weight of 784.44 g/mol. Its IUPAC name is [2,6-dichloro-4-[[1-[2-[[(2S)-1,4-dioxopentan-2-yl]amino]-2-oxoethyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamoyl]phenyl] 3,5-dichloro-4-hydroxybenzoate.
| Compound Name | [2,6-dichloro-4-[[1-[2-[[(2S)-1,4-dioxopentan-2-yl]amino]-2-oxoethyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamoyl]phenyl] 3,5-dichloro-4-hydroxybenzoate |
|---|---|
| PubChem CID | 59976322 |
| Molecular Formula | C36H26Cl4N4O8 |
| Molecular Weight | 784.44 g/mol |
| Exact Mass | 782.05 |
| IUPAC Name | [2,6-dichloro-4-[[1-[2-[[(2S)-1,4-dioxopentan-2-yl]amino]-2-oxoethyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamoyl]phenyl] 3,5-dichloro-4-hydroxybenzoate |
| SMILES | CC(=O)C[C@@H](C=O)NC(=O)CN1C(=O)C(NC(=O)c2cc(Cl)c(OC(=O)c3cc(Cl)c(O)c(Cl)c3)c(Cl)c2)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C36H26Cl4N4O8/c1-18(46)11-22(17-45)41-29(47)16-44-28-10-6-5-9-23(28)30(19-7-3-2-4-8-19)42-33(35(44)50)43-34(49)20-12-26(39)32(27(40)13-20)52-36(51)21-14-24(37)31(48)25(38)15-21/h2-10,12-15,17,22,33,48H,11,16H2,1H3,(H,41,47)(H,43,49)/t22-,33?/m0/s1 |
| InChIKey | CEAVDHOMDOUKJM-LJPZCQIFSA-N |
| XLogP | 5.83 |
| TPSA | 171.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|