C11H12O — CID 20713787
4a-methyl-7,8-dihydronaphthalen-2-one (PubChem CID 20713787) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is 4a-methyl-7,8-dihydronaphthalen-2-one.
| Compound Name | 4a-methyl-7,8-dihydronaphthalen-2-one |
|---|---|
| PubChem CID | 20713787 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 4a-methyl-7,8-dihydronaphthalen-2-one |
| SMILES | CC12C=CCCC1=CC(=O)C=C2 |
| InChI | InChI=1S/C11H12O/c1-11-6-3-2-4-9(11)8-10(12)5-7-11/h3,5-8H,2,4H2,1H3 |
| InChIKey | NZGXVPDMMGFKEZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|