C19H24O3 — CID 145003611
(2R,14S)-16-hydroxy-2,12,14-trimethyltetracyclo[8.6.0.02,7.011,14]hexadeca-3,6-diene-5,13-dione (PubChem CID 145003611) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2R,14S)-16-hydroxy-2,12,14-trimethyltetracyclo[8.6.0.02,7.011,14]hexadeca-3,6-diene-5,13-dione.
| Compound Name | (2R,14S)-16-hydroxy-2,12,14-trimethyltetracyclo[8.6.0.02,7.011,14]hexadeca-3,6-diene-5,13-dione |
|---|---|
| PubChem CID | 145003611 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (2R,14S)-16-hydroxy-2,12,14-trimethyltetracyclo[8.6.0.02,7.011,14]hexadeca-3,6-diene-5,13-dione |
| SMILES | CC1C(=O)[C@@]2(C)CC(O)C3C(CCC4=CC(=O)C=C[C@@]43C)C12 |
| InChI | InChI=1S/C19H24O3/c1-10-15-13-5-4-11-8-12(20)6-7-18(11,2)16(13)14(21)9-19(15,3)17(10)22/h6-8,10,13-16,21H,4-5,9H2,1-3H3/t10?,13?,14?,15?,16?,18-,19-/m0/s1 |
| InChIKey | KHRKPTCBWPCAMH-CZVPJRJJSA-N |
| XLogP | 2.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |