C24H38O3 — CID 142968481
ethane;5-hydroxy-4a,7,8-trimethyl-7-(2-oxopentan-3-yl)-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-one (PubChem CID 142968481) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is ethane;5-hydroxy-4a,7,8-trimethyl-7-(2-oxopentan-3-yl)-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-one.
| Compound Name | ethane;5-hydroxy-4a,7,8-trimethyl-7-(2-oxopentan-3-yl)-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-one |
|---|---|
| PubChem CID | 142968481 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | ethane;5-hydroxy-4a,7,8-trimethyl-7-(2-oxopentan-3-yl)-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-one |
| SMILES | CC.CCC(C(C)=O)C1(C)CC(O)C2C(CCC3=CC(=O)C=CC32C)C1C |
| InChI | InChI=1S/C22H32O3.C2H6/c1-6-18(14(3)23)22(5)12-19(25)20-17(13(22)2)8-7-15-11-16(24)9-10-21(15,20)4;1-2/h9-11,13,17-20,25H,6-8,12H2,1-5H3;1-2H3 |
| InChIKey | RTLROZPMGYOJGU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |