C14H32OSi — CID 20715705
2,2-dimethylpropyl-dimethyl-(2-methyl-3-propoxypropyl)silane (PubChem CID 20715705) has the molecular formula C14H32OSi and a molecular weight of 244.49 g/mol. Its IUPAC name is 2,2-dimethylpropyl-dimethyl-(2-methyl-3-propoxypropyl)silane.
| Compound Name | 2,2-dimethylpropyl-dimethyl-(2-methyl-3-propoxypropyl)silane |
|---|---|
| PubChem CID | 20715705 |
| Molecular Formula | C14H32OSi |
| Molecular Weight | 244.49 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 2,2-dimethylpropyl-dimethyl-(2-methyl-3-propoxypropyl)silane |
| SMILES | CCCOCC(C)C[Si](C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H32OSi/c1-8-9-15-10-13(2)11-16(6,7)12-14(3,4)5/h13H,8-12H2,1-7H3 |
| InChIKey | NMXKKMYVUVRLNH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|