C11H16N4O5 — CID 20716415
N-(2-acetamidoethyl)-2-(5-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)acetamide (PubChem CID 20716415) has the molecular formula C11H16N4O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-(5-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-(5-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)acetamide |
|---|---|
| PubChem CID | 20716415 |
| Molecular Formula | C11H16N4O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-(2-acetamidoethyl)-2-(5-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)acetamide |
| SMILES | CC(=O)NCCNC(=O)CC1(C)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C11H16N4O5/c1-6(16)12-3-4-13-7(17)5-11(2)8(18)14-10(20)15-9(11)19/h3-5H2,1-2H3,(H,12,16)(H,13,17)(H2,14,15,18,19,20) |
| InChIKey | BKFPRSIKSDUCJA-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|