C24H40AcO3 — CID 20719974
actinium;(1E,3E)-8,12-dimethyl-1-(6-methyl-1,4-dioxaspiro[4.5]decan-6-yl)trideca-1,3,11-trien-5-ol (PubChem CID 20719974) has the molecular formula C24H40AcO3 and a molecular weight of 603.58 g/mol. Its IUPAC name is actinium;(1E,3E)-8,12-dimethyl-1-(6-methyl-1,4-dioxaspiro[4.5]decan-6-yl)trideca-1,3,11-trien-5-ol.
| Compound Name | actinium;(1E,3E)-8,12-dimethyl-1-(6-methyl-1,4-dioxaspiro[4.5]decan-6-yl)trideca-1,3,11-trien-5-ol |
|---|---|
| PubChem CID | 20719974 |
| Molecular Formula | C24H40AcO3 |
| Molecular Weight | 603.58 g/mol |
| Exact Mass | 603.33 |
| IUPAC Name | actinium;(1E,3E)-8,12-dimethyl-1-(6-methyl-1,4-dioxaspiro[4.5]decan-6-yl)trideca-1,3,11-trien-5-ol |
| SMILES | CC(C)=CCCC(C)CCC(O)/C=C/C=C/C1(C)CCCCC12OCCO2.[Ac] |
| InChI | InChI=1S/C24H40O3.Ac/c1-20(2)10-9-11-21(3)13-14-22(25)12-5-6-15-23(4)16-7-8-17-24(23)26-18-19-27-24;/h5-6,10,12,15,21-22,25H,7-9,11,13-14,16-19H2,1-4H3;/b12-5+,15-6+; |
| InChIKey | UWXWGIWTXLALNL-RLHGAEEKSA-N |
| XLogP | 5.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|