C24H40O3 — CID 59870940
(1E,3E,5S,8S)-8,12-dimethyl-1-[(6S)-6-methyl-1,4-dioxaspiro[4.5]decan-6-yl]trideca-1,3,11-trien-5-ol (PubChem CID 59870940) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is (1E,3E,5S,8S)-8,12-dimethyl-1-[(6S)-6-methyl-1,4-dioxaspiro[4.5]decan-6-yl]trideca-1,3,11-trien-5-ol.
| Compound Name | (1E,3E,5S,8S)-8,12-dimethyl-1-[(6S)-6-methyl-1,4-dioxaspiro[4.5]decan-6-yl]trideca-1,3,11-trien-5-ol |
|---|---|
| PubChem CID | 59870940 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | (1E,3E,5S,8S)-8,12-dimethyl-1-[(6S)-6-methyl-1,4-dioxaspiro[4.5]decan-6-yl]trideca-1,3,11-trien-5-ol |
| SMILES | CC(C)=CCC[C@H](C)CC[C@H](O)/C=C/C=C/[C@]1(C)CCCCC12OCCO2 |
| InChI | InChI=1S/C24H40O3/c1-20(2)10-9-11-21(3)13-14-22(25)12-5-6-15-23(4)16-7-8-17-24(23)26-18-19-27-24/h5-6,10,12,15,21-22,25H,7-9,11,13-14,16-19H2,1-4H3/b12-5+,15-6+/t21-,22+,23+/m0/s1 |
| InChIKey | RMSHTAMKJXDHRT-SEPGGGRCSA-N |
| XLogP | 5.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|