C14H16N4O — CID 20720121
5,7,9,11,13-pentamethyl-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene (PubChem CID 20720121) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 5,7,9,11,13-pentamethyl-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene.
| Compound Name | 5,7,9,11,13-pentamethyl-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 20720121 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 5,7,9,11,13-pentamethyl-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene |
| SMILES | Cc1nc(C)c2c(n1)Oc1nc(C)nc(C)c1C2C |
| InChI | InChI=1S/C14H16N4O/c1-6-11-7(2)15-9(4)17-13(11)19-14-12(6)8(3)16-10(5)18-14/h6H,1-5H3 |
| InChIKey | YQGQWUOUMHEWLR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |