C7H10O5 — CID 20720716
4-(ethylperoxymethyl)-5-methyl-1,3-dioxol-2-one (PubChem CID 20720716) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is 4-(ethylperoxymethyl)-5-methyl-1,3-dioxol-2-one.
| Compound Name | 4-(ethylperoxymethyl)-5-methyl-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 20720716 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 4-(ethylperoxymethyl)-5-methyl-1,3-dioxol-2-one |
| SMILES | CCOOCc1oc(=O)oc1C |
| InChI | InChI=1S/C7H10O5/c1-3-9-10-4-6-5(2)11-7(8)12-6/h3-4H2,1-2H3 |
| InChIKey | MOUTWIZRVUUYSS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|