About 3H-dioxol-4-yl methyl carbonate
3H-dioxol-4-yl methyl carbonate (PubChem CID 140557809) has the molecular formula C5H6O5
and a molecular weight of 146.10 g/mol. Its IUPAC name is 3H-dioxol-4-yl methyl carbonate.
Molecular Properties
| Compound Name | 3H-dioxol-4-yl methyl carbonate |
| PubChem CID | 140557809 |
| Molecular Formula | C5H6O5 |
| Molecular Weight | 146.10 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | 3H-dioxol-4-yl methyl carbonate |
| SMILES | COC(=O)OC1=COOC1 |
| InChI | InChI=1S/C5H6O5/c1-7-5(6)10-4-2-8-9-3-4/h2H,3H2,1H3 |
| InChIKey | KQZHQVBCGMHSGB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.10 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3H-dioxol-4-yl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-dioxol-4-yl methyl carbonate?
The IUPAC name of 3H-dioxol-4-yl methyl carbonate (CID 140557809) is 3H-dioxol-4-yl methyl carbonate.
What is the SMILES notation for 3H-dioxol-4-yl methyl carbonate?
The canonical SMILES for 3H-dioxol-4-yl methyl carbonate is COC(=O)OC1=COOC1.
What is the InChIKey of 3H-dioxol-4-yl methyl carbonate?
The InChIKey is KQZHQVBCGMHSGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O5/c1-7-5(6)10-4-2-8-9-3-4/h2H,3H2,1H3.
What are the key properties of 3H-dioxol-4-yl methyl carbonate?
3H-dioxol-4-yl methyl carbonate has a molecular weight of 146.10 g/mol, XLogP of 0.57, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-dioxol-4-yl methyl carbonate is sourced from PubChem (CID 140557809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).