C11H20O — CID 20721971
1-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethanol (PubChem CID 20721971) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethanol.
| Compound Name | 1-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethanol |
|---|---|
| PubChem CID | 20721971 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 1-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)ethanol |
| SMILES | CC(O)C1CC2CC1C(C)C2C |
| InChI | InChI=1S/C11H20O/c1-6-7(2)10-4-9(6)5-11(10)8(3)12/h6-12H,4-5H2,1-3H3 |
| InChIKey | IUKFYNNXBUNKNH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |