C10H17+ — CID 144530808
2,3-dimethyl-5-methylbicyclo[2.2.1]heptane (PubChem CID 144530808) has the molecular formula C10H17+ and a molecular weight of 137.25 g/mol. Its IUPAC name is 2,3-dimethyl-5-methylbicyclo[2.2.1]heptane.
| Compound Name | 2,3-dimethyl-5-methylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 144530808 |
| Molecular Formula | C10H17+ |
| Molecular Weight | 137.25 g/mol |
| Exact Mass | 137.13 |
| IUPAC Name | 2,3-dimethyl-5-methylbicyclo[2.2.1]heptane |
| SMILES | [CH2+]C1CC2CC1C(C)C2C |
| InChI | InChI=1S/C10H17/c1-6-4-9-5-10(6)8(3)7(9)2/h6-10H,1,4-5H2,2-3H3/q+1 |
| InChIKey | OEBWHPHIOWAGOU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|