C11H16O — CID 122683103
5-ethynoxy-2,3-dimethylbicyclo[2.2.1]heptane (PubChem CID 122683103) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 5-ethynoxy-2,3-dimethylbicyclo[2.2.1]heptane.
| Compound Name | 5-ethynoxy-2,3-dimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 122683103 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 5-ethynoxy-2,3-dimethylbicyclo[2.2.1]heptane |
| SMILES | C#COC1CC2CC1C(C)C2C |
| InChI | InChI=1S/C11H16O/c1-4-12-11-6-9-5-10(11)8(3)7(9)2/h1,7-11H,5-6H2,2-3H3 |
| InChIKey | YEYKRAMNNXWCDP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|