C7H12+2 — CID 91257797
2-methyl-1,3-di(methyl)cyclobutane (PubChem CID 91257797) has the molecular formula C7H12+2 and a molecular weight of 96.17 g/mol. Its IUPAC name is 2-methyl-1,3-di(methyl)cyclobutane.
| Compound Name | 2-methyl-1,3-di(methyl)cyclobutane |
|---|---|
| PubChem CID | 91257797 |
| Molecular Formula | C7H12+2 |
| Molecular Weight | 96.17 g/mol |
| Exact Mass | 96.09 |
| IUPAC Name | 2-methyl-1,3-di(methyl)cyclobutane |
| SMILES | [CH2+]C1CC([CH2+])C1C |
| InChI | InChI=1S/C7H12/c1-5-4-6(2)7(5)3/h5-7H,1-2,4H2,3H3/q+2 |
| InChIKey | JFZGSZBRYCZESW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|