C16H18B16 — CID 20727447
CID 20727447 (PubChem CID 20727447) has the molecular formula C16H18B16 and a molecular weight of 383.31 g/mol.
| Compound Name | CID 20727447 |
|---|---|
| PubChem CID | 20727447 |
| Molecular Formula | C16H18B16 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | — |
| SMILES | [B]C([B])C(C([B])[B])C(C(C)C(C(C([B])[B])C([B])[B])C(C([B])[B])C([B])[B])C(C([B])[B])C([B])[B] |
| InChI | InChI=1S/C16H18B16/c1-2(3(5(9(17)18)10(19)20)6(11(21)22)12(23)24)4(7(13(25)26)14(27)28)8(15(29)30)16(31)32/h2-16H,1H3 |
| InChIKey | FAUMKQZCLVJZLP-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|