C36H24F6O8S2 — CID 20728926
bis[(Z)-3,3,3-trifluoro-2-(4-phenoxyphenyl)prop-1-enyl] benzene-1,3-disulfonate (PubChem CID 20728926) has the molecular formula C36H24F6O8S2 and a molecular weight of 762.70 g/mol. Its IUPAC name is bis[(Z)-3,3,3-trifluoro-2-(4-phenoxyphenyl)prop-1-enyl] benzene-1,3-disulfonate.
| Compound Name | bis[(Z)-3,3,3-trifluoro-2-(4-phenoxyphenyl)prop-1-enyl] benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 20728926 |
| Molecular Formula | C36H24F6O8S2 |
| Molecular Weight | 762.70 g/mol |
| Exact Mass | 762.08 |
| IUPAC Name | bis[(Z)-3,3,3-trifluoro-2-(4-phenoxyphenyl)prop-1-enyl] benzene-1,3-disulfonate |
| SMILES | O=S(=O)(O/C=C(/c1ccc(Oc2ccccc2)cc1)C(F)(F)F)c1cccc(S(=O)(=O)O/C=C(/c2ccc(Oc3ccccc3)cc2)C(F)(F)F)c1 |
| InChI | InChI=1S/C36H24F6O8S2/c37-35(38,39)33(25-14-18-29(19-15-25)49-27-8-3-1-4-9-27)23-47-51(43,44)31-12-7-13-32(22-31)52(45,46)48-24-34(36(40,41)42)26-16-20-30(21-17-26)50-28-10-5-2-6-11-28/h1-24H/b33-23-,34-24- |
| InChIKey | UMAHRVLFTWHAOO-DQWRGTGXSA-N |
| XLogP | 9.89 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.70 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|