C13H20O4Se — CID 20729123
2,4-dimethoxy-1-[2-(1-methoxyethoxy)ethylselanyl]benzene (PubChem CID 20729123) has the molecular formula C13H20O4Se and a molecular weight of 319.26 g/mol. Its IUPAC name is 2,4-dimethoxy-1-[2-(1-methoxyethoxy)ethylselanyl]benzene.
| Compound Name | 2,4-dimethoxy-1-[2-(1-methoxyethoxy)ethylselanyl]benzene |
|---|---|
| PubChem CID | 20729123 |
| Molecular Formula | C13H20O4Se |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2,4-dimethoxy-1-[2-(1-methoxyethoxy)ethylselanyl]benzene |
| SMILES | COc1ccc([Se]CCOC(C)OC)c(OC)c1 |
| InChI | InChI=1S/C13H20O4Se/c1-10(14-2)17-7-8-18-13-6-5-11(15-3)9-12(13)16-4/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | CDEMJFVUMJEOBX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|