C10H18N6 — CID 20729790
2-methyl-5-(4-methylpiperazin-1-yl)pyrimidine-4,6-diamine (PubChem CID 20729790) has the molecular formula C10H18N6 and a molecular weight of 222.30 g/mol. Its IUPAC name is 2-methyl-5-(4-methylpiperazin-1-yl)pyrimidine-4,6-diamine.
| Compound Name | 2-methyl-5-(4-methylpiperazin-1-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 20729790 |
| Molecular Formula | C10H18N6 |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-methyl-5-(4-methylpiperazin-1-yl)pyrimidine-4,6-diamine |
| SMILES | Cc1nc(N)c(N2CCN(C)CC2)c(N)n1 |
| InChI | InChI=1S/C10H18N6/c1-7-13-9(11)8(10(12)14-7)16-5-3-15(2)4-6-16/h3-6H2,1-2H3,(H4,11,12,13,14) |
| InChIKey | XCVHRONXWFTTFS-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |