C36H38O6 — CID 20730190
[4-[2-(4-acetyloxyphenyl)-5-hydroxypentan-2-yl]phenyl] 4-[2-(4-methoxyphenyl)propan-2-yl]benzoate (PubChem CID 20730190) has the molecular formula C36H38O6 and a molecular weight of 566.69 g/mol. Its IUPAC name is [4-[2-(4-acetyloxyphenyl)-5-hydroxypentan-2-yl]phenyl] 4-[2-(4-methoxyphenyl)propan-2-yl]benzoate.
| Compound Name | [4-[2-(4-acetyloxyphenyl)-5-hydroxypentan-2-yl]phenyl] 4-[2-(4-methoxyphenyl)propan-2-yl]benzoate |
|---|---|
| PubChem CID | 20730190 |
| Molecular Formula | C36H38O6 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | [4-[2-(4-acetyloxyphenyl)-5-hydroxypentan-2-yl]phenyl] 4-[2-(4-methoxyphenyl)propan-2-yl]benzoate |
| SMILES | COc1ccc(C(C)(C)c2ccc(C(=O)Oc3ccc(C(C)(CCCO)c4ccc(OC(C)=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H38O6/c1-25(38)41-32-19-13-29(14-20-32)36(4,23-6-24-37)30-15-21-33(22-16-30)42-34(39)26-7-9-27(10-8-26)35(2,3)28-11-17-31(40-5)18-12-28/h7-22,37H,6,23-24H2,1-5H3 |
| InChIKey | WARUQPQVFVJDPJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|