C45H43CoO6- — CID 89125385
1-[diphenyl(phenyl)methyl]-4-methoxybenzene;[4-[5-hydroxy-2-(4-hydroxyphenyl)pentan-2-yl]phenyl] acetate;oxocobalt (PubChem CID 89125385) has the molecular formula C45H43CoO6- and a molecular weight of 738.77 g/mol. Its IUPAC name is 1-[diphenyl(phenyl)methyl]-4-methoxybenzene;[4-[5-hydroxy-2-(4-hydroxyphenyl)pentan-2-yl]phenyl] acetate;oxocobalt.
| Compound Name | 1-[diphenyl(phenyl)methyl]-4-methoxybenzene;[4-[5-hydroxy-2-(4-hydroxyphenyl)pentan-2-yl]phenyl] acetate;oxocobalt |
|---|---|
| PubChem CID | 89125385 |
| Molecular Formula | C45H43CoO6- |
| Molecular Weight | 738.77 g/mol |
| Exact Mass | 738.24 |
| IUPAC Name | 1-[diphenyl(phenyl)methyl]-4-methoxybenzene;[4-[5-hydroxy-2-(4-hydroxyphenyl)pentan-2-yl]phenyl] acetate;oxocobalt |
| SMILES | CC(=O)Oc1ccc(C(C)(CCCO)c2ccc(O)cc2)cc1.COc1ccc(C(c2cc[c-]cc2)(c2ccccc2)c2ccccc2)cc1.O=[Co] |
| InChI | InChI=1S/C26H21O.C19H22O4.Co.O/c1-27-25-19-17-24(18-20-25)26(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23;1-14(21)23-18-10-6-16(7-11-18)19(2,12-3-13-20)15-4-8-17(22)9-5-15;;/h2-3,5-20H,1H3;4-11,20,22H,3,12-13H2,1-2H3;;/q-1;;; |
| InChIKey | HWLVUGYPVXDNQW-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.77 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|