C16H22O4 — CID 20731195
(1-oxospiro[3a,4,5,6,7,7a-hexahydro-2-benzofuran-3,1'-cyclopentane]-5-yl) 2-methylprop-2-enoate (PubChem CID 20731195) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (1-oxospiro[3a,4,5,6,7,7a-hexahydro-2-benzofuran-3,1'-cyclopentane]-5-yl) 2-methylprop-2-enoate.
| Compound Name | (1-oxospiro[3a,4,5,6,7,7a-hexahydro-2-benzofuran-3,1'-cyclopentane]-5-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20731195 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1-oxospiro[3a,4,5,6,7,7a-hexahydro-2-benzofuran-3,1'-cyclopentane]-5-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC2C(=O)OC3(CCCC3)C2C1 |
| InChI | InChI=1S/C16H22O4/c1-10(2)14(17)19-11-5-6-12-13(9-11)16(20-15(12)18)7-3-4-8-16/h11-13H,1,3-9H2,2H3 |
| InChIKey | ZSFVOXDZAKNBIS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|